ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
6020-54-8 2,4-Diamino-5-phenylthiazole monohydrobromide |
|
| Chemical Name | 2,4-Diamino-5-phenylthiazole monohydrobromide |
| Synonyms | Amiphenazole monohydrobromide;5-phenyl-1,3-thiazole-2,4-diamine hydrobromide (1:1) |
| Molecular Formula | C9H10BrN3S |
| Molecular Weight | 272.1648 |
| InChl | InChI=1/C9H9N3S.BrH/c10-8-7(13-9(11)12-8)6-4-2-1-3-5-6;/h1-5H,10H2,(H2,11,12);1H |
| CAS Registry Number | 6020-54-8 |
| EINECS | 227-874-8 |
| Molecular Structure | ![]() |
| Melting Point | 283℃ |
| Boiling Point | 413.3°C at 760 mmHg |
| Flash Point | 203.7°C |
| Vapour Pressur | 4.86E-07mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |