ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
64230-50-8 N-methyl-N-[(2-oxo-2,3-dihydro-1H-indol-3-yl)methyl]acetamide |
|
| Chemical Name | N-methyl-N-[(2-oxo-2,3-dihydro-1H-indol-3-yl)methyl]acetamide |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.2518 |
| InChl | InChI=1/C12H14N2O2/c1-8(15)14(2)7-10-9-5-3-4-6-11(9)13-12(10)16/h3-6,10H,7H2,1-2H3,(H,13,16) |
| CAS Registry Number | 64230-50-8 |
| Molecular Structure | ![]() |
| Density | 1.173g/cm3 |
| Boiling Point | 409.2°C at 760 mmHg |
| Refractive Index | 1.554 |
| Flash Point | 201.3°C |
| Vapour Pressur | 6.6E-07mmHg at 25°C |
| MSDS | |