ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68123-43-3 formic acid, compound with (R*,R*)-α-(1-aminoethyl)benzenemethanol (1:1) |
|
| Chemical Name | formic acid, compound with (R*,R*)-α-(1-aminoethyl)benzenemethanol (1:1) |
| Synonyms | Formic acid, compd. with rel-(alphaR)-alpha-((1R)-1-aminoethyl)benzenemethanol (1:1);Pseudonorephedrine formate;Formic acid, compound with (R*,R*)-alpha-(1-aminoethyl)benzenemethanol (1:1);formic acid - (1R,2R)-2-amino-1-phenylpropan-1-ol (1:1) |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.231 |
| InChl | InChI=1/C9H13NO.CH2O2/c1-7(10)9(11)8-5-3-2-4-6-8;2-1-3/h2-7,9,11H,10H2,1H3;1H,(H,2,3)/t7-,9+;/m1./s1 |
| CAS Registry Number | 68123-43-3 |
| EINECS | 268-560-0 |
| Molecular Structure | ![]() |
| Boiling Point | 288.1°C at 760 mmHg |
| Flash Point | 128.1°C |
| Vapour Pressur | 0.0011mmHg at 25°C |
| MSDS | |