68459-80-3 formic acid, compound with N,N-dimethylcyclohexylamine (1:1) |
|
| Product Name | formic acid, compound with N,N-dimethylcyclohexylamine (1:1) |
| Synonyms | Formic acid, compd. with N,N-dimethylcyclohexanamine (1:1);N,N-Dimethylcyclohexanamine, formate salt;Formic acid, compound with N,N-dimethylcyclohexylamine (1:1);formic acid - N,N-dimethylcyclohexanamine (1:1) |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.2527 |
| InChl | InChI=1/C8H17N.CH2O2/c1-9(2)8-6-4-3-5-7-8;2-1-3/h8H,3-7H2,1-2H3;1H,(H,2,3) |
| CAS Registry Number | 68459-80-3 |
| EINECS | 270-618-5 |
| Molecular Structure |  |
| Boiling Point | 162°C at 760 mmHg |
| Flash Point | 42.2°C |
| Vapour Pressur | 2.21mmHg at 25°C |
Chemindex > 68459-80-3 formic acid, compound with N,N-dimethylcyclohexylamine (1:1)