ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71720-38-2 5,5-diallylbarbituric acid, compound with 1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one |
|
Chemical Name | 5,5-diallylbarbituric acid, compound with 1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one |
Synonyms | 5,5-Diallylbarbituric acid, compound with 1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one;5,5-diallylhexahydropyrimidine-2,4,6-trione; 1,5-dimethyl-2-phenyl-pyrazol-3-one |
Molecular Formula | C21H24N4O4 |
Molecular Weight | 396.4397 |
InChl | InChI=1/C11H12N2O.C10H12N2O3/c1-9-8-11(14)13(12(9)2)10-6-4-3-5-7-10;1-3-5-10(6-4-2)7(13)11-9(15)12-8(10)14/h3-8H,1-2H3;3-4H,1-2,5-6H2,(H2,11,12,13,14,15) |
CAS Registry Number | 71720-38-2 |
EINECS | 275-886-7 |
Molecular Structure | ![]() |
Boiling Point | 513.4°C at 760 mmHg |
Flash Point | 264.3°C |
Vapour Pressur | 1.19E-10mmHg at 25°C |
MSDS |