ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7224-04-6 3,4,6-tri-O-acetyl-1,2-O-ethylidenehexopyranose |
|
| Chemical Name | 3,4,6-tri-O-acetyl-1,2-O-ethylidenehexopyranose |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.3032 |
| InChl | InChI=1/C14H20O9/c1-6(15)18-5-10-11(19-7(2)16)12(20-8(3)17)13-14(23-10)22-9(4)21-13/h9-14H,5H2,1-4H3 |
| CAS Registry Number | 7224-04-6 |
| Molecular Structure | ![]() |
| Density | 1.3g/cm3 |
| Boiling Point | 400.4°C at 760 mmHg |
| Refractive Index | 1.49 |
| Flash Point | 175.2°C |
| Vapour Pressur | 1.27E-06mmHg at 25°C |
| MSDS | |