ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
7271-46-7 5-propyl-1,2-dihydro-3H-1,2,4-triazole-3-thione |
|
| Chemical Name | 5-propyl-1,2-dihydro-3H-1,2,4-triazole-3-thione |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.2101 |
| InChl | InChI=1/C5H9N3S/c1-2-3-4-6-5(9)8-7-4/h2-3H2,1H3,(H2,6,7,8,9) |
| CAS Registry Number | 7271-46-7 |
| Molecular Structure | ![]() |
| Density | 1.34g/cm3 |
| Boiling Point | 187°C at 760 mmHg |
| Refractive Index | 1.662 |
| Flash Point | 66.9°C |
| Vapour Pressur | 0.644mmHg at 25°C |
| MSDS | |