ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
74754-50-0 4,5-diamino-9-pentofuranosyl-3,9-dihydro-2H-pyrrolo[2,3-d:5,4-d']dipyrimidin-2-one |
|
| Chemical Name | 4,5-diamino-9-pentofuranosyl-3,9-dihydro-2H-pyrrolo[2,3-d:5,4-d']dipyrimidin-2-one |
| Molecular Formula | C13H15N7O5 |
| Molecular Weight | 349.3021 |
| InChl | InChI=1/C13H15N7O5/c14-8-4-5-9(15)18-13(24)19-11(5)20(10(4)17-2-16-8)12-7(23)6(22)3(1-21)25-12/h2-3,6-7,12,21-23H,1H2,(H2,14,16,17)(H3,15,18,19,24) |
| CAS Registry Number | 74754-50-0 |
| Molecular Structure | ![]() |
| Density | 2.38g/cm3 |
| Refractive Index | 2.079 |
| MSDS | |