77902-86-4 sulphuric acid, compound with 2H-1-benzopyran-2-one (1:1) |
|
| Product Name | sulphuric acid, compound with 2H-1-benzopyran-2-one (1:1) |
| Synonyms | Sulfuric acid, compd. with 2H-1-benzopyran-2-one (1:1);1-Benzopyrylium, 2-hydroxy-, bisulfate salt;Sulphuric acid, compound with 2H-1-benzopyran-2-one (1:1);2H-chromen-2-one - sulfuric acid (1:1) |
| Molecular Formula | C9H8O6S |
| Molecular Weight | 244.2212 |
| InChl | InChI=1/C9H6O2.H2O4S/c10-9-6-5-7-3-1-2-4-8(7)11-9;1-5(2,3)4/h1-6H;(H2,1,2,3,4) |
| CAS Registry Number | 77902-86-4 |
| EINECS | 278-789-8 |
| Molecular Structure |  |
| Boiling Point | 298°C at 760 mmHg |
| Flash Point | 118.3°C |
| Vapour Pressur | 0.0013mmHg at 25°C |
Chemindex > 77902-86-4 sulphuric acid, compound with 2H-1-benzopyran-2-one (1:1)