ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
81382-09-4 N-[(7-cyano-2,11-dimethoxy-3,12,16-trimethyl-1,4,10,13-tetraoxo-1,5,6,7,9,10,13,14,14a,15-decahydro-4H-6,15-epiminoisoquino[3,2-b][3]benzazocin-9-yl)methyl]-2-hydroxypropanamide |
|
| Chemical Name | N-[(7-cyano-2,11-dimethoxy-3,12,16-trimethyl-1,4,10,13-tetraoxo-1,5,6,7,9,10,13,14,14a,15-decahydro-4H-6,15-epiminoisoquino[3,2-b][3]benzazocin-9-yl)methyl]-2-hydroxypropanamide |
| Molecular Formula | C29H32N4O8 |
| Molecular Weight | 564.5864 |
| InChl | InChI=1/C29H32N4O8/c1-11-23(35)14-8-17-22-21-15(24(36)12(2)28(41-6)26(21)38)7-16(32(22)4)18(9-30)33(17)19(10-31-29(39)13(3)34)20(14)25(37)27(11)40-5/h13,16-19,22,34H,7-8,10H2,1-6H3,(H,31,39) |
| CAS Registry Number | 81382-09-4 |
| Molecular Structure | ![]() |
| Density | 1.44g/cm3 |
| Boiling Point | 869.6°C at 760 mmHg |
| Refractive Index | 1.637 |
| Flash Point | 479.7°C |
| Vapour Pressur | 2.65E-35mmHg at 25°C |
| MSDS | |