ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94535-60-1 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2,4-bis-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]hexopyranoside |
|
| Chemical Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 2,4-bis-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]hexopyranoside |
| Molecular Formula | C39H32O15 |
| Molecular Weight | 740.6624 |
| InChl | InChI=1/C39H32O15/c40-19-29-36(52-30(46)15-5-20-1-9-23(41)10-2-20)34(49)38(53-31(47)16-6-21-3-11-24(42)12-4-21)39(51-29)54-37-33(48)32-27(45)17-26(44)18-28(32)50-35(37)22-7-13-25(43)14-8-22/h1-18,29,34,36,38-45,49H,19H2/b15-5+,16-6+ |
| CAS Registry Number | 94535-60-1 |
| Molecular Structure | ![]() |
| Density | 1.63g/cm3 |
| Boiling Point | 1006.8°C at 760 mmHg |
| Refractive Index | 1.751 |
| Flash Point | 314.2°C |
| Vapour Pressur | 0mmHg at 25°C |
| MSDS | |