ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
98992-22-4 cyano(3-phenoxyphenyl)methyl (2-methyl-1-phenylpropyl)carbamate |
|
| Chemical Name | cyano(3-phenoxyphenyl)methyl (2-methyl-1-phenylpropyl)carbamate |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.4697 |
| InChl | InChI=1/C25H24N2O3/c1-18(2)24(19-10-5-3-6-11-19)27-25(28)30-23(17-26)20-12-9-15-22(16-20)29-21-13-7-4-8-14-21/h3-16,18,23-24H,1-2H3,(H,27,28) |
| CAS Registry Number | 98992-22-4 |
| Molecular Structure | ![]() |
| Density | 1.165g/cm3 |
| Boiling Point | 558.9°C at 760 mmHg |
| Refractive Index | 1.584 |
| Flash Point | 291.8°C |
| Vapour Pressur | 1.59E-12mmHg at 25°C |
| MSDS | |