ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
104-83-6 4-Chlorobenzyl chloride |
|
| Chemical Name | 4-Chlorobenzyl chloride |
| Synonyms | PCBC;alpha,4-Dichlorotoluene;1-chloro-4-(chloromethyl)-benzene;(4-chlorophenyl)methylchloride;4-Dichlorotoluene;1-chloro-4-(chloromethyl)-benzen;a13-14884;Benzene,1-chloro-4-(chloromethyl)-;chlorobenzylchlorides;p,alpha-dichloro-toluen;p,alpha-Dichlorotoluene;p-chlorobenzyl chloride;para chlorobenzyl chloride |
| Molecular Formula | C7H6Cl2 |
| Molecular Weight | 161.0285 |
| InChl | InChI=1/C7H6Cl2/c8-5-6-1-3-7(9)4-2-6/h1-4H,5H2 |
| CAS Registry Number | 104-83-6 |
| EINECS | 203-242-7 |
| Molecular Structure | ![]() |
| Density | 1.247g/cm3 |
| Melting Point | 27-28℃ |
| Boiling Point | 223°C at 760 mmHg |
| Refractive Index | 1.546 |
| Flash Point | 87.3°C |
| Water Solubility | insoluble |
| Vapour Pressur | 0.147mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22||R34||R51/53:; |
| Safety Description | S26||S29||S36/37/39||S45:; |
| MSDS | |