ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-83-2 Butyl epoxystearate |
|
| Chemical Name | Butyl epoxystearate |
| Synonyms | 203-434-0;Butyl 8-(3-octyloxiran-2-yl)octanoate |
| Molecular Formula | C22H42O3 |
| Molecular Weight | 354.5671 |
| InChl | InChI=1/C22H42O3/c1-3-5-7-8-10-13-16-20-21(25-20)17-14-11-9-12-15-18-22(23)24-19-6-4-2/h20-21H,3-19H2,1-2H3 |
| CAS Registry Number | 106-83-2 |
| EINECS | 203-434-0 |
| Molecular Structure | ![]() |
| Density | 0.916g/cm3 |
| Boiling Point | 428.8°C at 760 mmHg |
| Refractive Index | 1.456 |
| Flash Point | 163.2°C |
| Vapour Pressur | 1.47E-07mmHg at 25°C |
| MSDS | |