ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
108-02-1 captamine |
|
| Chemical Name | captamine |
| Synonyms | Captamine [INN];(2-Mercaptoethyl)dimethylamine;(Dimethylamino)ethyl mercaptan;2-(Dimethylamino)ethanethiol;2-(p-(Butylthio)benzhydrylthio)-N,N-dimethylethylamin;4-04-00-01579 (Beilstein Handbook Reference);BRN 1071198;Captamina;Captamina [INN-Spanish];Captamine;Captaminum;Captaminum [INN-Latin];N,N-Dimethylcysteamine;N-Dimethyl cysteamin;N-Dimethyl cysteamin [German];UNII-9FS0ENU0GR;p-Butylthiobenzhydryl-2-dimethylaminoethyl-sulfid;Ethanethiol, 2-(dimethylamino)- |
| Molecular Formula | C4H11NS |
| Molecular Weight | 105.2018 |
| InChl | InChI=1/C4H11NS/c1-5(2)3-4-6/h6H,3-4H2,1-2H3 |
| CAS Registry Number | 108-02-1 |
| EINECS | 203-543-3 |
| Molecular Structure | ![]() |
| Density | 0.907g/cm3 |
| Boiling Point | 121.9°C at 760 mmHg |
| Refractive Index | 1.467 |
| Flash Point | 27.5°C |
| Vapour Pressur | 14.3mmHg at 25°C |
| MSDS | |