ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112270-43-6 3-methyl-5-(7-{4-[(4S)-4-(1-methylethyl)-4,5-dihydro-1,3-oxazol-2-yl]phenoxy}heptyl)isoxazole |
|
| Chemical Name | 3-methyl-5-(7-{4-[(4S)-4-(1-methylethyl)-4,5-dihydro-1,3-oxazol-2-yl]phenoxy}heptyl)isoxazole |
| Synonyms | Isoxazole, 5-[7-[4-[(4S)-4,5-dihydro-4-(1-methylethyl)-2-oxazolyl]phenoxy]heptyl]-3-methyl- |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.5118 |
| InChl | InChI=1/C23H32N2O3/c1-17(2)22-16-27-23(24-22)19-10-12-20(13-11-19)26-14-8-6-4-5-7-9-21-15-18(3)25-28-21/h10-13,15,17,22H,4-9,14,16H2,1-3H3/t22-/m1/s1 |
| CAS Registry Number | 112270-43-6 |
| Molecular Structure | ![]() |
| Density | 1.11g/cm3 |
| Boiling Point | 541.1°C at 760 mmHg |
| Refractive Index | 1.557 |
| Flash Point | 281.1°C |
| Vapour Pressur | 3.16E-11mmHg at 25°C |
| MSDS | |