ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112473-91-3 3-phenoxybenzyl 2-(2-cyanoethyl)-3-methylbutanoate |
|
| Chemical Name | 3-phenoxybenzyl 2-(2-cyanoethyl)-3-methylbutanoate |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.4122 |
| InChl | InChI=1/C21H23NO3/c1-16(2)20(12-7-13-22)21(23)24-15-17-8-6-11-19(14-17)25-18-9-4-3-5-10-18/h3-6,8-11,14,16,20H,7,12,15H2,1-2H3 |
| CAS Registry Number | 112473-91-3 |
| Molecular Structure | ![]() |
| Density | 1.102g/cm3 |
| Boiling Point | 483.2°C at 760 mmHg |
| Refractive Index | 1.541 |
| Flash Point | 210.1°C |
| Vapour Pressur | 1.71E-09mmHg at 25°C |
| MSDS | |