ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112473-96-8 3-phenoxybenzyl 3-methyl-2-(pentyloxy)butanoate |
|
| Chemical Name | 3-phenoxybenzyl 3-methyl-2-(pentyloxy)butanoate |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.4819 |
| InChl | InChI=1/C23H30O4/c1-4-5-9-15-25-22(18(2)3)23(24)26-17-19-11-10-14-21(16-19)27-20-12-7-6-8-13-20/h6-8,10-14,16,18,22H,4-5,9,15,17H2,1-3H3 |
| CAS Registry Number | 112473-96-8 |
| Molecular Structure | ![]() |
| Density | 1.052g/cm3 |
| Boiling Point | 475.3°C at 760 mmHg |
| Refractive Index | 1.522 |
| Flash Point | 203.8°C |
| Vapour Pressur | 3.36E-09mmHg at 25°C |
| MSDS | |