ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112474-11-0 3-phenoxybenzyl 3-methyl-2-(propan-2-yl)pentanoate |
|
| Chemical Name | 3-phenoxybenzyl 3-methyl-2-(propan-2-yl)pentanoate |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.4559 |
| InChl | InChI=1/C22H28O3/c1-5-17(4)21(16(2)3)22(23)24-15-18-10-9-13-20(14-18)25-19-11-7-6-8-12-19/h6-14,16-17,21H,5,15H2,1-4H3 |
| CAS Registry Number | 112474-11-0 |
| Molecular Structure | ![]() |
| Density | 1.033g/cm3 |
| Boiling Point | 424.5°C at 760 mmHg |
| Refractive Index | 1.524 |
| Flash Point | 180.7°C |
| Vapour Pressur | 2.06E-07mmHg at 25°C |
| MSDS | |