ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112474-12-1 3-phenoxybenzyl 2-(propan-2-yl)nonanoate |
|
| Chemical Name | 3-phenoxybenzyl 2-(propan-2-yl)nonanoate |
| Molecular Formula | C25H34O3 |
| Molecular Weight | 382.5357 |
| InChl | InChI=1/C25H34O3/c1-4-5-6-7-11-17-24(20(2)3)25(26)27-19-21-13-12-16-23(18-21)28-22-14-9-8-10-15-22/h8-10,12-16,18,20,24H,4-7,11,17,19H2,1-3H3 |
| CAS Registry Number | 112474-12-1;112489-92-6 |
| Molecular Structure | ![]() |
| Density | 1.01g/cm3 |
| Boiling Point | 468.5°C at 760 mmHg |
| Refractive Index | 1.518 |
| Flash Point | 201.5°C |
| Vapour Pressur | 5.94E-09mmHg at 25°C |
| MSDS | |