ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
114184-76-8 3-methyl-2-nitro-1,2-dihydroacenaphthylen-1-ol |
|
| Chemical Name | 3-methyl-2-nitro-1,2-dihydroacenaphthylen-1-ol |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.2313 |
| InChl | InChI=1/C13H11NO3/c1-7-5-6-8-3-2-4-9-11(8)10(7)12(13(9)15)14(16)17/h2-6,12-13,15H,1H3 |
| CAS Registry Number | 114184-76-8 |
| Molecular Structure | ![]() |
| Density | 1.39g/cm3 |
| Boiling Point | 478.7°C at 760 mmHg |
| Refractive Index | 1.7 |
| Flash Point | 208.7°C |
| Vapour Pressur | 5.69E-10mmHg at 25°C |
| MSDS | |