ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
115239-52-6 4-tert-butylphenol: formaldehyde: 4-[2-(4-hydroxyphenyl)-1-methyl-ethyl]phenol |
|
| Chemical Name | 4-tert-butylphenol: formaldehyde: 4-[2-(4-hydroxyphenyl)-1-methyl-ethyl]phenol |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.5299 |
| InChl | InChI=1/C15H16O2.C10H14O.CH2O/c1-11(13-4-8-15(17)9-5-13)10-12-2-6-14(16)7-3-12;1-10(2,3)8-4-6-9(11)7-5-8;1-2/h2-9,11,16-17H,10H2,1H3;4-7,11H,1-3H3;1H2 |
| CAS Registry Number | 115239-52-6;54579-44-1;67953-88-2;68227-14-5 |
| Molecular Structure | ![]() |
| Boiling Point | 374.9°C at 760 mmHg |
| Flash Point | 177.6°C |
| Vapour Pressur | 3.74E-06mmHg at 25°C |
| MSDS | |