ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
115399-96-7 3-phenethyl-3-azabicyclo(3.2.1)octan-8-ol |
|
| Chemical Name | 3-phenethyl-3-azabicyclo(3.2.1)octan-8-ol |
| Synonyms | 3-Phenethyl-3-azabicyclo(3.2.1)octan-8-ol;3-Pabcoo;3-(2-phenylethyl)-3-azabicyclo[3.2.1]octan-8-ol |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.3333 |
| InChl | InChI=1/C15H21NO/c17-15-13-6-7-14(15)11-16(10-13)9-8-12-4-2-1-3-5-12/h1-5,13-15,17H,6-11H2 |
| CAS Registry Number | 115399-96-7 |
| Molecular Structure | ![]() |
| Density | 1.105g/cm3 |
| Boiling Point | 375.3°C at 760 mmHg |
| Refractive Index | 1.576 |
| Flash Point | 130.5°C |
| Vapour Pressur | 2.67E-06mmHg at 25°C |
| MSDS | |