ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
120375-11-3 3-O-(A-L-FUCOPYRANOSYL)-D-GALACTOSE |
|
| Chemical Name | 3-O-(A-L-FUCOPYRANOSYL)-D-GALACTOSE |
| Synonyms | 3-O-(alpha-L-Fucopyranosyl)-D-galactose;3-O-(a-L-Fucopyranosyl)-D-galactopyranose;3-O-(α-L-Fucopyranosyl)-D-galactose |
| Molecular Formula | C12H22O10 |
| Molecular Weight | 326.2971 |
| InChl | InChI=1/C12H22O10/c1-3-5(14)7(16)8(17)12(20-3)22-10-6(15)4(2-13)21-11(19)9(10)18/h3-19H,2H2,1H3/t3?,4?,5-,6+,7+,8?,9?,10+,11?,12+/m1/s1 |
| CAS Registry Number | 120375-11-3 |
| Molecular Structure | ![]() |
| Refractive Index | 1.624 |
| MSDS | |