ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
123312-06-1 3-phenoxybenzyl (4-methylphenyl)propan-2-ylcarbamate |
|
| Chemical Name | 3-phenoxybenzyl (4-methylphenyl)propan-2-ylcarbamate |
| Synonyms | Carbamic acid, (4-methylphenyl)(1-methylethyl)-, (3-phenoxyphenyl)methyl ester |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.4602 |
| InChl | InChI=1/C24H25NO3/c1-18(2)25(21-14-12-19(3)13-15-21)24(26)27-17-20-8-7-11-23(16-20)28-22-9-5-4-6-10-22/h4-16,18H,17H2,1-3H3 |
| CAS Registry Number | 123312-06-1 |
| Molecular Structure | ![]() |
| Density | 1.143g/cm3 |
| Boiling Point | 509.9°C at 760 mmHg |
| Refractive Index | 1.597 |
| Flash Point | 262.2°C |
| Vapour Pressur | 1.62E-10mmHg at 25°C |
| MSDS | |