ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
126650-73-5 3-phenyl-7-pyrrolidin-1-yl-4H-[1,2,4]triazino[3,4-a]phthalazine |
|
| Chemical Name | 3-phenyl-7-pyrrolidin-1-yl-4H-[1,2,4]triazino[3,4-a]phthalazine |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.3984 |
| InChl | InChI=1/C20H19N5/c1-2-8-15(9-3-1)18-14-25-19(22-21-18)16-10-4-5-11-17(16)20(23-25)24-12-6-7-13-24/h1-5,8-11H,6-7,12-14H2 |
| CAS Registry Number | 126650-73-5 |
| Molecular Structure | ![]() |
| Density | 1.33g/cm3 |
| Boiling Point | 501.5°C at 760 mmHg |
| Refractive Index | 1.732 |
| Flash Point | 257.1°C |
| Vapour Pressur | 3.46E-10mmHg at 25°C |
| MSDS | |