ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
130946-61-1 3-methyl-1-(4-methylquinolin-2-yl)-1,4-dihydroindeno[1,2-c]pyrazole |
|
| Chemical Name | 3-methyl-1-(4-methylquinolin-2-yl)-1,4-dihydroindeno[1,2-c]pyrazole |
| Molecular Formula | C21H17N3 |
| Molecular Weight | 311.3798 |
| InChl | InChI=1/C21H17N3/c1-13-11-20(22-19-10-6-5-8-16(13)19)24-21-17-9-4-3-7-15(17)12-18(21)14(2)23-24/h3-11H,12H2,1-2H3 |
| CAS Registry Number | 130946-61-1 |
| Molecular Structure | ![]() |
| Density | 1.26g/cm3 |
| Boiling Point | 534.8°C at 760 mmHg |
| Refractive Index | 1.709 |
| Flash Point | 277.2°C |
| Vapour Pressur | 5.66E-11mmHg at 25°C |
| MSDS | |