ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
143265-29-6 3-nitrobenzo[pqr]tetraphene-6-carbonitrile |
|
| Chemical Name | 3-nitrobenzo[pqr]tetraphene-6-carbonitrile |
| Molecular Formula | C21H10N2O2 |
| Molecular Weight | 322.3163 |
| InChl | InChI=1/C21H10N2O2/c22-11-18-14-4-2-1-3-13(14)15-7-5-12-6-10-19(23(24)25)17-9-8-16(18)21(15)20(12)17/h1-10H |
| CAS Registry Number | 143265-29-6 |
| Molecular Structure | ![]() |
| Density | 1.46g/cm3 |
| Boiling Point | 598.2°C at 760 mmHg |
| Refractive Index | 1.868 |
| Flash Point | 315.6°C |
| Vapour Pressur | 2.86E-14mmHg at 25°C |
| MSDS | |