ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1608-11-3 1,1',1'',1'''-(1E,3E)-buta-1,3-diene-1,2,3,4-tetrayltetrabenzene |
|
| Chemical Name | 1,1',1'',1'''-(1E,3E)-buta-1,3-diene-1,2,3,4-tetrayltetrabenzene |
| Synonyms | 1,3-Butadiene, 1,2,3,4-tetraphenyl-;benzene, 1,1',1'',1'''-(1,3-butadiene-1,2,3,4-tetrayl)tetrakis- |
| Molecular Formula | C28H22 |
| Molecular Weight | 358.4743 |
| InChl | InChI=1/C28H22/c1-5-13-23(14-6-1)21-27(25-17-9-3-10-18-25)28(26-19-11-4-12-20-26)22-24-15-7-2-8-16-24/h1-22H/b27-21+,28-22+ |
| CAS Registry Number | 1608-11-3;806-71-3 |
| Molecular Structure | ![]() |
| Density | 1.108g/cm3 |
| Boiling Point | 495.1°C at 760 mmHg |
| Refractive Index | 1.682 |
| Flash Point | 252.5°C |
| Vapour Pressur | 1.85E-09mmHg at 25°C |
| MSDS | |