ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
174635-69-9 3-methyl-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide |
|
| Chemical Name | 3-methyl-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide |
| Synonyms | 3-Methyl-2-phenyl-N-[(1S)-1-phenylpropyl]quinoline-4-carboxamide;4-Quinolinecarboxamide, 3-methyl-2-phenyl-N-[(1S)-1-phenylpropyl]- |
| Molecular Formula | C26H24N2O |
| Molecular Weight | 380.4816 |
| InChl | InChI=1/C26H24N2O/c1-3-22(19-12-6-4-7-13-19)28-26(29)24-18(2)25(20-14-8-5-9-15-20)27-23-17-11-10-16-21(23)24/h4-17,22H,3H2,1-2H3,(H,28,29)/t22-/m0/s1 |
| CAS Registry Number | 174635-69-9 |
| Molecular Structure | ![]() |
| Density | 1.142g/cm3 |
| Boiling Point | 553.5°C at 760 mmHg |
| Refractive Index | 1.633 |
| Flash Point | 288.6°C |
| Vapour Pressur | 2.7E-12mmHg at 25°C |
| MSDS | |