ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
205-29-8 7H-pyrido[4,3-c]carbazole |
|
| Chemical Name | 7H-pyrido[4,3-c]carbazole |
| Molecular Formula | C15H10N2 |
| Molecular Weight | 218.2533 |
| InChl | InChI=1/C15H10N2/c1-2-4-13-11(3-1)15-12-9-16-8-7-10(12)5-6-14(15)17-13/h1-9,17H |
| CAS Registry Number | 205-29-8 |
| Molecular Structure | ![]() |
| Density | 1.336g/cm3 |
| Boiling Point | 488.6°C at 760 mmHg |
| Refractive Index | 1.839 |
| Flash Point | 229.1°C |
| Vapour Pressur | 3.21E-09mmHg at 25°C |
| MSDS | |