ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
226416-58-6 2-(phenoxymethyl)-4-[3-(piperidin-1-yl)propoxy]-1-[3-(piperidin-4-yl)propyl]-1H-benzimidazole |
|
| Chemical Name | 2-(phenoxymethyl)-4-[3-(piperidin-1-yl)propoxy]-1-[3-(piperidin-4-yl)propyl]-1H-benzimidazole |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.68 |
| InChl | InChI=1/C30H42N4O2/c1-3-11-26(12-4-1)36-24-29-32-30-27(34(29)22-8-10-25-15-17-31-18-16-25)13-7-14-28(30)35-23-9-21-33-19-5-2-6-20-33/h1,3-4,7,11-14,25,31H,2,5-6,8-10,15-24H2 |
| CAS Registry Number | 226416-58-6 |
| Molecular Structure | ![]() |
| Density | 1.17g/cm3 |
| Boiling Point | 678.3°C at 760 mmHg |
| Refractive Index | 1.612 |
| Flash Point | 364°C |
| Vapour Pressur | 2.95E-18mmHg at 25°C |
| MSDS | |