ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
287494-25-1 2-methyl-5-(3-pyridyl)pyrazol-3-amine |
|
| Chemical Name | 2-methyl-5-(3-pyridyl)pyrazol-3-amine |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.2025 |
| InChl | InChI=1/C9H10N4/c1-13-9(10)5-8(12-13)7-3-2-4-11-6-7/h2-6H,10H2,1H3 |
| CAS Registry Number | 287494-25-1 |
| Molecular Structure | ![]() |
| Density | 1.27g/cm3 |
| Boiling Point | 398.7°C at 760 mmHg |
| Refractive Index | 1.665 |
| Flash Point | 194.9°C |
| Vapour Pressur | 1.45E-06mmHg at 25°C |
| MSDS | |