ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29581-98-4 3-{[(2R)-2-(carboxyamino)-3-oxopropyl]disulfanyl}-N-formyl-L-alanine |
|
| Chemical Name | 3-{[(2R)-2-(carboxyamino)-3-oxopropyl]disulfanyl}-N-formyl-L-alanine |
| Molecular Formula | C8H12N2O6S2 |
| Molecular Weight | 296.3207 |
| InChl | InChI=1/C8H12N2O6S2/c11-1-5(10-8(15)16)2-17-18-3-6(7(13)14)9-4-12/h1,4-6,10H,2-3H2,(H,9,12)(H,13,14)(H,15,16)/t5-,6+/m1/s1 |
| CAS Registry Number | 29581-98-4;816-91-1 |
| Molecular Structure | ![]() |
| Density | 1.553g/cm3 |
| Refractive Index | 1.605 |
| MSDS | |