ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
303010-08-4 4-[(5-{[(naphthalen-1-ylmethyl)sulfanyl]methyl}-4-phenyl-4H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzaldehyde |
|
| Chemical Name | 4-[(5-{[(naphthalen-1-ylmethyl)sulfanyl]methyl}-4-phenyl-4H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzaldehyde |
| Synonyms | 4-[(5-{[(1-Naphthylmethyl)sulfanyl]methyl}-4-phenyl-4H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrobenzaldehyde;benzaldehyde, 4-[[5-[[(1-naphthalenylmethyl)thio]methyl]-4-phenyl-4H-1,2,4-triazol-3-yl]thio]-3-nitro- |
| Molecular Formula | C27H20N4O3S2 |
| Molecular Weight | 512.6027 |
| InChl | InChI=1/C27H20N4O3S2/c32-16-19-13-14-25(24(15-19)31(33)34)36-27-29-28-26(30(27)22-10-2-1-3-11-22)18-35-17-21-9-6-8-20-7-4-5-12-23(20)21/h1-16H,17-18H2 |
| CAS Registry Number | 303010-08-4 |
| Molecular Structure | ![]() |
| Density | 1.36g/cm3 |
| Boiling Point | 750°C at 760 mmHg |
| Refractive Index | 1.707 |
| Flash Point | 407.4°C |
| Vapour Pressur | 2.25E-22mmHg at 25°C |
| MSDS | |