ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
343604-07-9 3',4'-dimethylbiphenyl-3-carbaldehyde |
|
| Chemical Name | 3',4'-dimethylbiphenyl-3-carbaldehyde |
| Synonyms | [1,1'-Biphenyl]-3-carboxaldehyde, 3',4'-dimethyl-;3',4'-Dimethylbiphenyl-3-carbaldehyde |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.2711 |
| InChl | InChI=1/C15H14O/c1-11-6-7-15(8-12(11)2)14-5-3-4-13(9-14)10-16/h3-10H,1-2H3 |
| CAS Registry Number | 343604-07-9 |
| Molecular Structure | ![]() |
| Density | 1.056g/cm3 |
| Boiling Point | 353.6°C at 760 mmHg |
| Refractive Index | 1.591 |
| Flash Point | 187.8°C |
| Vapour Pressur | 3.55E-05mmHg at 25°C |
| MSDS | |