ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
365542-49-0 4-[2-[3-methoxy-4-[4-[2-(4-pyridyl)ethyl]phenoxy]phenyl]ethyl]pyridine dihydrochloride |
|
| Chemical Name | 4-[2-[3-methoxy-4-[4-[2-(4-pyridyl)ethyl]phenoxy]phenyl]ethyl]pyridine dihydrochloride |
| Molecular Formula | C27H28Cl2N2O2 |
| Molecular Weight | 483.4294 |
| InChl | InChI=1/C27H26N2O2.2ClH/c1-30-27-20-24(5-4-23-14-18-29-19-15-23)8-11-26(27)31-25-9-6-21(7-10-25)2-3-22-12-16-28-17-13-22;;/h6-20H,2-5H2,1H3;2*1H |
| CAS Registry Number | 365542-49-0 |
| Molecular Structure | ![]() |
| MSDS | |