ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
403-90-7 3-Fluoro-DL-tyrosine |
|
| Chemical Name | 3-Fluoro-DL-tyrosine |
| Synonyms | H-DL-Tyr(3-F)-OH |
| Molecular Formula | C9H10FNO3 |
| Molecular Weight | 199.179 |
| InChl | InChI=1/C9H10FNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m1/s1 |
| CAS Registry Number | 403-90-7 |
| EINECS | 206-964-0 |
| Molecular Structure | ![]() |
| Density | 1.421g/cm3 |
| Melting Point | 276-280℃ |
| Boiling Point | 362.4°C at 760 mmHg |
| Refractive Index | 1.591 |
| Flash Point | 172.9°C |
| Vapour Pressur | 6.94E-06mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |