ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4132-48-3 4-Isopropylanisole |
|
| Chemical Name | 4-Isopropylanisole |
| Synonyms | 4-Methoxycumene;1-methoxy-4-(propan-2-yl)benzene;2-[(4-methoxybenzyl)sulfanyl]-5-[(4-nitrobenzyl)sulfanyl]-1,3,4-thiadiazole |
| Molecular Formula | C17H15N3O3S3 |
| Molecular Weight | 405.5143 |
| InChl | InChI=1/C17H15N3O3S3/c1-23-15-8-4-13(5-9-15)11-25-17-19-18-16(26-17)24-10-12-2-6-14(7-3-12)20(21)22/h2-9H,10-11H2,1H3 |
| CAS Registry Number | 4132-48-3 |
| EINECS | 223-952-0 |
| Molecular Structure | ![]() |
| Density | 1.45g/cm3 |
| Boiling Point | 614.5°C at 760 mmHg |
| Refractive Index | 1.696 |
| Flash Point | 325.4°C |
| Vapour Pressur | 2.25E-14mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |