ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
494799-20-1 methyl 3-cyclohexyl-2-(furan-3-yl)-1H-indole-6-carboxylate |
|
| Chemical Name | methyl 3-cyclohexyl-2-(furan-3-yl)-1H-indole-6-carboxylate |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.3856 |
| InChl | InChI=1/C20H21NO3/c1-23-20(22)14-7-8-16-17(11-14)21-19(15-9-10-24-12-15)18(16)13-5-3-2-4-6-13/h7-13,21H,2-6H2,1H3 |
| CAS Registry Number | 494799-20-1 |
| Molecular Structure | ![]() |
| Density | 1.201g/cm3 |
| Boiling Point | 506.5°C at 760 mmHg |
| Refractive Index | 1.608 |
| Flash Point | 260.1°C |
| Vapour Pressur | 2.2E-10mmHg at 25°C |
| MSDS | |