ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
505-54-4 Hexadecanedioic acid |
|
| Chemical Name | Hexadecanedioic acid |
| Synonyms | Thapsic acid;1,16-Hexadecanedioic acid;Hexadecane Diacid;hexadecanedioate |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.3922 |
| InChl | InChI=1/C16H30O4/c17-15(18)13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(19)20/h1-14H2,(H,17,18)(H,19,20)/p-2 |
| CAS Registry Number | 505-54-4 |
| EINECS | 208-013-5 |
| Molecular Structure | ![]() |
| Melting Point | 120-123℃ |
| Boiling Point | 457.5°C at 760 mmHg |
| Flash Point | 244.6°C |
| Vapour Pressur | 1.22E-09mmHg at 25°C |
| Safety Description | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |