ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50606-96-7 4-heptylbenzoyl chloride |
|
| Chemical Name | 4-heptylbenzoyl chloride |
| Synonyms | 4-n-Heptylbenzoyl chloride |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.7531 |
| InChl | InChI=1/C14H19ClO/c1-2-3-4-5-6-7-12-8-10-13(11-9-12)14(15)16/h8-11H,2-7H2,1H3 |
| CAS Registry Number | 50606-96-7 |
| EINECS | 256-648-1 |
| Molecular Structure | ![]() |
| Density | 1.032g/cm3 |
| Boiling Point | 321.5°C at 760 mmHg |
| Refractive Index | 1.51 |
| Flash Point | 149.4°C |
| Vapour Pressur | 0.000296mmHg at 25°C |
| MSDS | |