50712-68-0 4-Chloro-2-methylbenzonitrile |
|
| Product Name | 4-Chloro-2-methylbenzonitrile |
| Synonyms | 4-Chloro-2-methyl-benzonitrile |
| Molecular Formula | C8H6ClN |
| Molecular Weight | 151.5929 |
| InChl | InChI=1/C8H6ClN/c1-6-4-8(9)3-2-7(6)5-10/h2-4H,1H3 |
| CAS Registry Number | 50712-68-0 |
| Molecular Structure |  |
| Density | 1.19g/cm3 |
| Melting Point | 57-61℃ |
| Boiling Point | 239.8°C at 760 mmHg |
| Refractive Index | 1.553 |
| Flash Point | 97.1°C |
| Vapour Pressur | 0.0393mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
