ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50807-41-5 4,4-dimethyl-2,5-dioxoimidazolidine-1,3-dipropionic acid |
|
| Chemical Name | 4,4-dimethyl-2,5-dioxoimidazolidine-1,3-dipropionic acid |
| Synonyms | 4,4-Dimethyl-2,5-dioxoimidazolidine-1,3-dipropionic acid;3,3'-(4,4-dimethyl-2,5-dioxoimidazolidine-1,3-diyl)dipropanoic acid |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.2545 |
| InChl | InChI=1/C11H16N2O6/c1-11(2)9(18)12(5-3-7(14)15)10(19)13(11)6-4-8(16)17/h3-6H2,1-2H3,(H,14,15)(H,16,17) |
| CAS Registry Number | 50807-41-5 |
| EINECS | 256-773-1 |
| Molecular Structure | ![]() |
| Density | 1.363g/cm3 |
| Boiling Point | 475.3°C at 760 mmHg |
| Refractive Index | 1.529 |
| Flash Point | 241.2°C |
| Vapour Pressur | 2.42E-10mmHg at 25°C |
| MSDS | |