ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51-48-9 L-Thyroxine |
|
| Chemical Name | L-Thyroxine |
| Synonyms | levothyroxine;3-[4-(4-Hydroxy-3,5-diiodophenoxy)-3,5-diiodophenyl]-alanine;3,5,3',5'-tetraiodothyronine;beta-[(3,5-diiodo-4-hydroxyphenoxy)-3,5-diiodophenyl]alanine;l-3,5,3',5'-tetraiodothyronine;l-t4;o-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-l-tyrosin;o-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodotyrosine;t4(hormone);tetraiodothyronine;O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo-L-tyrosine |
| Molecular Formula | C15H11I4NO4 |
| Molecular Weight | 776.87 |
| InChl | InChI=1/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1 |
| CAS Registry Number | 51-48-9;25416-65-3 |
| EINECS | 200-101-1 |
| Molecular Structure | ![]() |
| Density | 2.635g/cm3 |
| Melting Point | 223℃ (dec.) |
| Boiling Point | 576.3°C at 760 mmHg |
| Refractive Index | 1.795 |
| Flash Point | 302.3°C |
| Water Solubility | insoluble |
| Vapour Pressur | 4.02E-14mmHg at 25°C |
| Hazard Symbols | |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S24/25:; |
| MSDS | |