ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
51867-94-8 4-(2-hydroxy-5,7-dimethyl-4-oxodeca-6,8-dien-1-yl)piperidine-2,6-dione |
|
| Chemical Name | 4-(2-hydroxy-5,7-dimethyl-4-oxodeca-6,8-dien-1-yl)piperidine-2,6-dione |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.3847 |
| InChl | InChI=1/C17H25NO4/c1-4-5-11(2)6-12(3)15(20)10-14(19)7-13-8-16(21)18-17(22)9-13/h4-6,12-14,19H,7-10H2,1-3H3,(H,18,21,22) |
| CAS Registry Number | 51867-94-8 |
| Molecular Structure | ![]() |
| Density | 1.095g/cm3 |
| Boiling Point | 519.5°C at 760 mmHg |
| Refractive Index | 1.509 |
| Flash Point | 268°C |
| Vapour Pressur | 5.76E-13mmHg at 25°C |
| MSDS | |