ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52401-15-7 4-[2-(5-ammonio-2-methyl-1,3-benzodioxol-2-yl)ethyl]morpholin-4-ium dichloride |
|
| Chemical Name | 4-[2-(5-ammonio-2-methyl-1,3-benzodioxol-2-yl)ethyl]morpholin-4-ium dichloride |
| Molecular Formula | C14H22Cl2N2O3 |
| Molecular Weight | 337.2421 |
| InChl | InChI=1/C14H20N2O3.2ClH/c1-14(4-5-16-6-8-17-9-7-16)18-12-3-2-11(15)10-13(12)19-14;;/h2-3,10H,4-9,15H2,1H3;2*1H |
| CAS Registry Number | 52401-15-7 |
| Molecular Structure | ![]() |
| Boiling Point | 404.5°C at 760 mmHg |
| Flash Point | 198.4°C |
| Vapour Pressur | 9.43E-07mmHg at 25°C |
| MSDS | |