ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52423-56-0 4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide monohydrochloride |
|
| Chemical Name | 4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide monohydrochloride |
| Synonyms | Bromopride hydrochloride;Bromoprid hydrochlorid;Bromopride HCl;Cascapride;Opridan;4-Amino-5-bromo-N-(2-(diethylamino)ethyl)-2-methoxybenzamide monohydrochloride;4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride |
| Molecular Formula | C14H23BrClN3O2 |
| Molecular Weight | 380.7083 |
| InChl | InChI=1/C14H22BrN3O2.ClH/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3;/h8-9H,4-7,16H2,1-3H3,(H,17,19);1H |
| CAS Registry Number | 52423-56-0 |
| EINECS | 257-906-6 |
| Molecular Structure | ![]() |
| Boiling Point | 435.8°C at 760 mmHg |
| Flash Point | 217.3°C |
| Vapour Pressur | 8.53E-08mmHg at 25°C |
| MSDS | |