ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52444-78-7 4-methoxy-N-[(3Z)-5-(methylsulfanyl)-4-phenyl-3H-1,2-dithiol-3-ylidene]aniline |
|
| Chemical Name | 4-methoxy-N-[(3Z)-5-(methylsulfanyl)-4-phenyl-3H-1,2-dithiol-3-ylidene]aniline |
| Synonyms | 4-Methoxy-N-(5-(methylthio)-4-phenyl-3H-1,2-dithiol-3-ylidene)aniline;N-(4-Methoxyphenyl)-N-(5-(methylthio)-4-phenyl-3H-1,2-dithiol-3-ylidene)amine |
| Molecular Formula | C17H15NOS3 |
| Molecular Weight | 345.5021 |
| InChl | InChI=1/C17H15NOS3/c1-19-14-10-8-13(9-11-14)18-16-15(17(20-2)22-21-16)12-6-4-3-5-7-12/h3-11H,1-2H3/b18-16- |
| CAS Registry Number | 52444-78-7 |
| Molecular Structure | ![]() |
| Density | 1.26g/cm3 |
| Boiling Point | 519.8°C at 760 mmHg |
| Refractive Index | 1.657 |
| Flash Point | 268.2°C |
| Vapour Pressur | 2.17E-10mmHg at 25°C |
| MSDS | |