ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
53525-84-1 4-methoxy-N-[(4aR,8aS)-2-methyldecahydroisoquinolin-8-yl]benzamide |
|
| Chemical Name | 4-methoxy-N-[(4aR,8aS)-2-methyldecahydroisoquinolin-8-yl]benzamide |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.4112 |
| InChl | InChI=1/C18H26N2O2/c1-20-11-10-13-4-3-5-17(16(13)12-20)19-18(21)14-6-8-15(22-2)9-7-14/h6-9,13,16-17H,3-5,10-12H2,1-2H3,(H,19,21)/t13-,16-,17?/m1/s1 |
| CAS Registry Number | 53525-84-1 |
| Molecular Structure | ![]() |
| Density | 1.12g/cm3 |
| Boiling Point | 468.4°C at 760 mmHg |
| Refractive Index | 1.567 |
| Flash Point | 237.1°C |
| Vapour Pressur | 6E-09mmHg at 25°C |
| MSDS | |